C81H52 — CID 177106593
1,3-bis(prop-1-ynyl)-5-[2-[4-[tris[4-[2-[3,5-bis(prop-1-ynyl)phenyl]ethynyl]phenyl]methyl]phenyl]ethynyl]benzene (PubChem CID 177106593) has the molecular formula C81H52 and a molecular weight of 1025.31 g/mol. Its IUPAC name is 1,3-bis(prop-1-ynyl)-5-[2-[4-[tris[4-[2-[3,5-bis(prop-1-ynyl)phenyl]ethynyl]phenyl]methyl]phenyl]ethynyl]benzene.
| Compound Name | 1,3-bis(prop-1-ynyl)-5-[2-[4-[tris[4-[2-[3,5-bis(prop-1-ynyl)phenyl]ethynyl]phenyl]methyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 177106593 |
| Molecular Formula | C81H52 |
| Molecular Weight | 1025.31 g/mol |
| Exact Mass | 1024.41 |
| IUPAC Name | 1,3-bis(prop-1-ynyl)-5-[2-[4-[tris[4-[2-[3,5-bis(prop-1-ynyl)phenyl]ethynyl]phenyl]methyl]phenyl]ethynyl]benzene |
| SMILES | CC#Cc1cc(C#CC)cc(C#Cc2ccc(C(c3ccc(C#Cc4cc(C#CC)cc(C#CC)c4)cc3)(c3ccc(C#Cc4cc(C#CC)cc(C#CC)c4)cc3)c3ccc(C#Cc4cc(C#CC)cc(C#CC)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C81H52/c1-9-17-65-49-66(18-10-2)54-73(53-65)29-25-61-33-41-77(42-34-61)81(78-43-35-62(36-44-78)26-30-74-55-67(19-11-3)50-68(56-74)20-12-4,79-45-37-63(38-46-79)27-31-75-57-69(21-13-5)51-70(58-75)22-14-6)80-47-39-64(40-48-80)28-32-76-59-71(23-15-7)52-72(60-76)24-16-8/h33-60H,1-8H3 |
| InChIKey | QTLTXFAOOJIHEQ-UHFFFAOYSA-N |
| XLogP | 14.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.31 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|