C19H18F2O3 — CID 174877647
5-[2-[4-(1,1-difluoroethyl)phenyl]ethynyl]-1,2,3-trimethoxybenzene (PubChem CID 174877647) has the molecular formula C19H18F2O3 and a molecular weight of 332.35 g/mol. Its IUPAC name is 5-[2-[4-(1,1-difluoroethyl)phenyl]ethynyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[2-[4-(1,1-difluoroethyl)phenyl]ethynyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 174877647 |
| Molecular Formula | C19H18F2O3 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-[2-[4-(1,1-difluoroethyl)phenyl]ethynyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(C#Cc2ccc(C(C)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18F2O3/c1-19(20,21)15-9-7-13(8-10-15)5-6-14-11-16(22-2)18(24-4)17(12-14)23-3/h7-12H,1-4H3 |
| InChIKey | XQFBFJLJXWDJJB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|