C27H21F3O — CID 21359814
1-methoxy-2,5-bis[2-(4-methylphenyl)ethynyl]-3-(2,2,2-trifluoroethyl)benzene (PubChem CID 21359814) has the molecular formula C27H21F3O and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-methoxy-2,5-bis[2-(4-methylphenyl)ethynyl]-3-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1-methoxy-2,5-bis[2-(4-methylphenyl)ethynyl]-3-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 21359814 |
| Molecular Formula | C27H21F3O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-methoxy-2,5-bis[2-(4-methylphenyl)ethynyl]-3-(2,2,2-trifluoroethyl)benzene |
| SMILES | COc1cc(C#Cc2ccc(C)cc2)cc(CC(F)(F)F)c1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C27H21F3O/c1-19-4-8-21(9-5-19)12-13-23-16-24(18-27(28,29)30)25(26(17-23)31-3)15-14-22-10-6-20(2)7-11-22/h4-11,16-17H,18H2,1-3H3 |
| InChIKey | REBJCQKERRITHT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|