C36H30O3 — CID 101355911
1,3,5-trimethoxy-2,4,6-tris[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 101355911) has the molecular formula C36H30O3 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2,4,6-tris[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 1,3,5-trimethoxy-2,4,6-tris[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 101355911 |
| Molecular Formula | C36H30O3 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1,3,5-trimethoxy-2,4,6-tris[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | COc1c(C#Cc2ccc(C)cc2)c(OC)c(C#Cc2ccc(C)cc2)c(OC)c1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C36H30O3/c1-25-7-13-28(14-8-25)19-22-31-34(37-4)32(23-20-29-15-9-26(2)10-16-29)36(39-6)33(35(31)38-5)24-21-30-17-11-27(3)12-18-30/h7-18H,1-6H3 |
| InChIKey | QZFCOSJVAGGGDO-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|