C26H21FO2 — CID 21360204
5-[2-(3-fluoro-4-methylphenyl)ethynyl]-1,3-dimethoxy-2-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 21360204) has the molecular formula C26H21FO2 and a molecular weight of 384.45 g/mol. Its IUPAC name is 5-[2-(3-fluoro-4-methylphenyl)ethynyl]-1,3-dimethoxy-2-[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 5-[2-(3-fluoro-4-methylphenyl)ethynyl]-1,3-dimethoxy-2-[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 21360204 |
| Molecular Formula | C26H21FO2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-[2-(3-fluoro-4-methylphenyl)ethynyl]-1,3-dimethoxy-2-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | COc1cc(C#Cc2ccc(C)c(F)c2)cc(OC)c1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C26H21FO2/c1-18-5-8-20(9-6-18)13-14-23-25(28-3)16-22(17-26(23)29-4)12-11-21-10-7-19(2)24(27)15-21/h5-10,15-17H,1-4H3 |
| InChIKey | FTWZHUVJLZGLRO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|