C32H28O6 — CID 171920382
2,7-bis[2-(3,4,5-trimethoxyphenyl)ethynyl]naphthalene (PubChem CID 171920382) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is 2,7-bis[2-(3,4,5-trimethoxyphenyl)ethynyl]naphthalene.
| Compound Name | 2,7-bis[2-(3,4,5-trimethoxyphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 171920382 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2,7-bis[2-(3,4,5-trimethoxyphenyl)ethynyl]naphthalene |
| SMILES | COc1cc(C#Cc2ccc3ccc(C#Cc4cc(OC)c(OC)c(OC)c4)cc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H28O6/c1-33-27-17-23(18-28(34-2)31(27)37-5)9-7-21-11-13-25-14-12-22(16-26(25)15-21)8-10-24-19-29(35-3)32(38-6)30(20-24)36-4/h11-20H,1-6H3 |
| InChIKey | SHOQJAXZEHFCRR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|