C33H26N2O5 — CID 171920243
2-[2-(3,5-dimethoxyphenyl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline (PubChem CID 171920243) has the molecular formula C33H26N2O5 and a molecular weight of 530.58 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxyphenyl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline.
| Compound Name | 2-[2-(3,5-dimethoxyphenyl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 171920243 |
| Molecular Formula | C33H26N2O5 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-[2-(3,5-dimethoxyphenyl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline |
| SMILES | COc1cc(C#Cc2ccc3ccc4ccc(C#Cc5cc(OC)c(OC)c(OC)c5)nc4c3n2)cc(OC)c1 |
| InChI | InChI=1S/C33H26N2O5/c1-36-27-16-21(17-28(20-27)37-2)6-12-25-14-10-23-8-9-24-11-15-26(35-32(24)31(23)34-25)13-7-22-18-29(38-3)33(40-5)30(19-22)39-4/h8-11,14-20H,1-5H3 |
| InChIKey | KYYVHQRYIGIYJM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|