C17H17NO4 — CID 18674976
[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methanol (PubChem CID 18674976) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is [2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methanol.
| Compound Name | [2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 18674976 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methanol |
| SMILES | COc1cc(C#Cc2cc(CO)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17NO4/c1-20-15-9-12(10-16(21-2)17(15)22-3)4-5-14-8-13(11-19)6-7-18-14/h6-10,19H,11H2,1-3H3 |
| InChIKey | RLLXUHDWIXFEFV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|