C38H42N4O6 — CID 142882136
1-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,2-dihydropyridin-4-yl]methyl]-4-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methyl]piperazine (PubChem CID 142882136) has the molecular formula C38H42N4O6 and a molecular weight of 650.78 g/mol. Its IUPAC name is 1-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,2-dihydropyridin-4-yl]methyl]-4-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methyl]piperazine.
| Compound Name | 1-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,2-dihydropyridin-4-yl]methyl]-4-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 142882136 |
| Molecular Formula | C38H42N4O6 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 1-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,2-dihydropyridin-4-yl]methyl]-4-[[2-[2-(3,4,5-trimethoxyphenyl)ethynyl]-4-pyridinyl]methyl]piperazine |
| SMILES | COc1cc(C#Cc2cc(CN3CCN(CC4=CC(C#Cc5cc(OC)c(OC)c(OC)c5)NC=C4)CC3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C38H42N4O6/c1-43-33-21-27(22-34(44-2)37(33)47-5)7-9-31-19-29(11-13-39-31)25-41-15-17-42(18-16-41)26-30-12-14-40-32(20-30)10-8-28-23-35(45-3)38(48-6)36(24-28)46-4/h11-14,19-24,31,39H,15-18,25-26H2,1-6H3 |
| InChIKey | VCNCRXQJPVCQQD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|