C22H32N2O3 — CID 11893055
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 11893055) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 11893055 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(CN2CCN(C[C@@H]3C[C@@H]4C=C[C@H]3C4)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H32N2O3/c1-25-20-12-17(13-21(26-2)22(20)27-3)14-23-6-8-24(9-7-23)15-19-11-16-4-5-18(19)10-16/h4-5,12-13,16,18-19H,6-11,14-15H2,1-3H3/t16-,18+,19+/m1/s1 |
| InChIKey | ACUYWIJYRNMARV-NEWSRXKRSA-N |
| XLogP | 3.04 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|