C21H30N2O3 — CID 2880200
4-[[4-(2-bicyclo[2.2.1]hept-5-enylmethyl)piperazin-1-yl]methyl]-2,6-dimethoxyphenol (PubChem CID 2880200) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-[[4-(2-bicyclo[2.2.1]hept-5-enylmethyl)piperazin-1-yl]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[4-(2-bicyclo[2.2.1]hept-5-enylmethyl)piperazin-1-yl]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 2880200 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 4-[[4-(2-bicyclo[2.2.1]hept-5-enylmethyl)piperazin-1-yl]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CN2CCN(CC3CC4C=CC3C4)CC2)cc(OC)c1O |
| InChI | InChI=1S/C21H30N2O3/c1-25-19-11-16(12-20(26-2)21(19)24)13-22-5-7-23(8-6-22)14-18-10-15-3-4-17(18)9-15/h3-4,11-12,15,17-18,24H,5-10,13-14H2,1-2H3 |
| InChIKey | MSURZBNKYVTSRB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|