C24H24O6 — CID 171369103
1,2,3-trimethoxy-5-[(Z)-6-(3,4,5-trimethoxyphenyl)hex-3-en-1,5-diynyl]benzene (PubChem CID 171369103) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-6-(3,4,5-trimethoxyphenyl)hex-3-en-1,5-diynyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-6-(3,4,5-trimethoxyphenyl)hex-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 171369103 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-6-(3,4,5-trimethoxyphenyl)hex-3-en-1,5-diynyl]benzene |
| SMILES | COc1cc(C#C/C=C\C#Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24O6/c1-25-19-13-17(14-20(26-2)23(19)29-5)11-9-7-8-10-12-18-15-21(27-3)24(30-6)22(16-18)28-4/h7-8,13-16H,1-6H3/b8-7- |
| InChIKey | QCJPNJGVNNMFDI-FPLPWBNLSA-N |
| XLogP | 3.70 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|