C30H23F5O6 — CID 156587898
1,2,3,4,5-pentafluoro-6-[4-(3,4,5-trimethoxyphenyl)-2-[2-(3,4,5-trimethoxyphenyl)ethynyl]but-1-en-3-ynyl]benzene (PubChem CID 156587898) has the molecular formula C30H23F5O6 and a molecular weight of 574.50 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-(3,4,5-trimethoxyphenyl)-2-[2-(3,4,5-trimethoxyphenyl)ethynyl]but-1-en-3-ynyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-(3,4,5-trimethoxyphenyl)-2-[2-(3,4,5-trimethoxyphenyl)ethynyl]but-1-en-3-ynyl]benzene |
|---|---|
| PubChem CID | 156587898 |
| Molecular Formula | C30H23F5O6 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-(3,4,5-trimethoxyphenyl)-2-[2-(3,4,5-trimethoxyphenyl)ethynyl]but-1-en-3-ynyl]benzene |
| SMILES | COc1cc(C#CC(C#Cc2cc(OC)c(OC)c(OC)c2)=Cc2c(F)c(F)c(F)c(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C30H23F5O6/c1-36-20-12-17(13-21(37-2)29(20)40-5)9-7-16(11-19-24(31)26(33)28(35)27(34)25(19)32)8-10-18-14-22(38-3)30(41-6)23(15-18)39-4/h11-15H,1-6H3 |
| InChIKey | JEDXWZRHWOCEJL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|