C25H20N4O5 — CID 73054725
2-[[2-[6-(2,2-dicyanoethenyl)-2,3,4-trimethoxyphenyl]-4,5-dimethoxyphenyl]methylidene]propanedinitrile (PubChem CID 73054725) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is 2-[[2-[6-(2,2-dicyanoethenyl)-2,3,4-trimethoxyphenyl]-4,5-dimethoxyphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[2-[6-(2,2-dicyanoethenyl)-2,3,4-trimethoxyphenyl]-4,5-dimethoxyphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 73054725 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[[2-[6-(2,2-dicyanoethenyl)-2,3,4-trimethoxyphenyl]-4,5-dimethoxyphenyl]methylidene]propanedinitrile |
| SMILES | COc1cc(C=C(C#N)C#N)c(-c2c(C=C(C#N)C#N)cc(OC)c(OC)c2OC)cc1OC |
| InChI | InChI=1S/C25H20N4O5/c1-30-20-8-17(6-15(11-26)12-27)19(10-21(20)31-2)23-18(7-16(13-28)14-29)9-22(32-3)24(33-4)25(23)34-5/h6-10H,1-5H3 |
| InChIKey | XNISPAQDCSYLKQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|