C20H15BrN2O5 — CID 19211332
[4-(2,2-dicyanoethenyl)phenyl] 2-bromo-3,4,5-trimethoxybenzoate (PubChem CID 19211332) has the molecular formula C20H15BrN2O5 and a molecular weight of 443.25 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 2-bromo-3,4,5-trimethoxybenzoate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 2-bromo-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 19211332 |
| Molecular Formula | C20H15BrN2O5 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 2-bromo-3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C=C(C#N)C#N)cc2)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C20H15BrN2O5/c1-25-16-9-15(17(21)19(27-3)18(16)26-2)20(24)28-14-6-4-12(5-7-14)8-13(10-22)11-23/h4-9H,1-3H3 |
| InChIKey | VMAXPVMQLACGQR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 101.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|