C18H16BrNO6 — CID 110494493
(2-methyl-1,3-benzoxazol-6-yl) 2-bromo-3,4,5-trimethoxybenzoate (PubChem CID 110494493) has the molecular formula C18H16BrNO6 and a molecular weight of 422.23 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl) 2-bromo-3,4,5-trimethoxybenzoate.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl) 2-bromo-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 110494493 |
| Molecular Formula | C18H16BrNO6 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl) 2-bromo-3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc3nc(C)oc3c2)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C18H16BrNO6/c1-9-20-12-6-5-10(7-13(12)25-9)26-18(21)11-8-14(22-2)16(23-3)17(24-4)15(11)19/h5-8H,1-4H3 |
| InChIKey | NDNRHSPWDIVFCE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|