C16H10F3NO3 — CID 110494488
(2-methyl-1,3-benzoxazol-6-yl) 4-(trifluoromethyl)benzoate (PubChem CID 110494488) has the molecular formula C16H10F3NO3 and a molecular weight of 321.25 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl) 4-(trifluoromethyl)benzoate.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl) 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 110494488 |
| Molecular Formula | C16H10F3NO3 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl) 4-(trifluoromethyl)benzoate |
| SMILES | Cc1nc2ccc(OC(=O)c3ccc(C(F)(F)F)cc3)cc2o1 |
| InChI | InChI=1S/C16H10F3NO3/c1-9-20-13-7-6-12(8-14(13)22-9)23-15(21)10-2-4-11(5-3-10)16(17,18)19/h2-8H,1H3 |
| InChIKey | RSVULQCCYUKHIN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|