C16H13NO4 — CID 110494411
(2-methyl-1,3-benzoxazol-6-yl) 2-methoxybenzoate (PubChem CID 110494411) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl) 2-methoxybenzoate.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl) 2-methoxybenzoate |
|---|---|
| PubChem CID | 110494411 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl) 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C16H13NO4/c1-10-17-13-8-7-11(9-15(13)20-10)21-16(18)12-5-3-4-6-14(12)19-2/h3-9H,1-2H3 |
| InChIKey | NFKGRIILGXWMKS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|