C16H15NO5S — CID 110504421
(2-methyl-1,3-benzoxazol-6-yl) 2-methoxy-5-methylbenzenesulfonate (PubChem CID 110504421) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl) 2-methoxy-5-methylbenzenesulfonate.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl) 2-methoxy-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 110504421 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl) 2-methoxy-5-methylbenzenesulfonate |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Oc1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C16H15NO5S/c1-10-4-7-14(20-3)16(8-10)23(18,19)22-12-5-6-13-15(9-12)21-11(2)17-13/h4-9H,1-3H3 |
| InChIKey | LXNJFMCZAJKUKC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|