C17H15NO5 — CID 110494414
(2-methyl-1,3-benzoxazol-6-yl) 3,5-dimethoxybenzoate (PubChem CID 110494414) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl) 3,5-dimethoxybenzoate.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl) 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 110494414 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl) 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2ccc3nc(C)oc3c2)c1 |
| InChI | InChI=1S/C17H15NO5/c1-10-18-15-5-4-12(9-16(15)22-10)23-17(19)11-6-13(20-2)8-14(7-11)21-3/h4-9H,1-3H3 |
| InChIKey | LKHUSDRNGJOSQB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|