C14H16N3O4S+ — CID 101028619
[2-(2,2-dicyanoethenyl)-5-methoxy-4-sulfophenyl]-trimethylazanium (PubChem CID 101028619) has the molecular formula C14H16N3O4S+ and a molecular weight of 322.37 g/mol. Its IUPAC name is [2-(2,2-dicyanoethenyl)-5-methoxy-4-sulfophenyl]-trimethylazanium.
| Compound Name | [2-(2,2-dicyanoethenyl)-5-methoxy-4-sulfophenyl]-trimethylazanium |
|---|---|
| PubChem CID | 101028619 |
| Molecular Formula | C14H16N3O4S+ |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [2-(2,2-dicyanoethenyl)-5-methoxy-4-sulfophenyl]-trimethylazanium |
| SMILES | COc1cc([N+](C)(C)C)c(C=C(C#N)C#N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C14H15N3O4S/c1-17(2,3)12-7-13(21-4)14(22(18,19)20)6-11(12)5-10(8-15)9-16/h5-7H,1-4H3/p+1 |
| InChIKey | FJNAABCALMAQPQ-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|