C15H14NaO11S2+ — CID 18798261
sodium 4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfobenzoyl)-2-methoxybenzenesulfonic acid (PubChem CID 18798261) has the molecular formula C15H14NaO11S2+ and a molecular weight of 457.39 g/mol. Its IUPAC name is sodium 4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfobenzoyl)-2-methoxybenzenesulfonic acid.
| Compound Name | sodium 4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfobenzoyl)-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 18798261 |
| Molecular Formula | C15H14NaO11S2+ |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | sodium 4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfobenzoyl)-2-methoxybenzenesulfonic acid |
| SMILES | COc1cc(O)c(C(=O)c2cc(S(=O)(=O)O)c(OC)cc2O)cc1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C15H14O11S2.Na/c1-25-11-5-9(16)7(3-13(11)27(19,20)21)15(18)8-4-14(28(22,23)24)12(26-2)6-10(8)17;/h3-6,16-17H,1-2H3,(H,19,20,21)(H,22,23,24);/q;+1 |
| InChIKey | LGTYGZVKKFRJKW-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|