C22H14N4O4 — CID 10739616
2-[[3-[5-(2,2-dicyanoethenyl)-2-hydroxy-3-methoxyphenyl]-4-hydroxy-5-methoxyphenyl]methylidene]propanedinitrile (PubChem CID 10739616) has the molecular formula C22H14N4O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-[[3-[5-(2,2-dicyanoethenyl)-2-hydroxy-3-methoxyphenyl]-4-hydroxy-5-methoxyphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-[5-(2,2-dicyanoethenyl)-2-hydroxy-3-methoxyphenyl]-4-hydroxy-5-methoxyphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 10739616 |
| Molecular Formula | C22H14N4O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[[3-[5-(2,2-dicyanoethenyl)-2-hydroxy-3-methoxyphenyl]-4-hydroxy-5-methoxyphenyl]methylidene]propanedinitrile |
| SMILES | COc1cc(C=C(C#N)C#N)cc(-c2cc(C=C(C#N)C#N)cc(OC)c2O)c1O |
| InChI | InChI=1S/C22H14N4O4/c1-29-19-7-13(3-15(9-23)10-24)5-17(21(19)27)18-6-14(4-16(11-25)12-26)8-20(30-2)22(18)28/h3-8,27-28H,1-2H3 |
| InChIKey | WWGYFDPJLPRUAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 154.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|