C10H4Cl2N2O — CID 3963824
2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]propanedinitrile (PubChem CID 3963824) has the molecular formula C10H4Cl2N2O and a molecular weight of 239.06 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]propanedinitrile.
| Compound Name | 2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 3963824 |
| Molecular Formula | C10H4Cl2N2O |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C10H4Cl2N2O/c11-8-2-6(1-7(4-13)5-14)3-9(12)10(8)15/h1-3,15H |
| InChIKey | VRFUIEKRFCDQED-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|