C18H9Cl2NO3 — CID 74047601
2-(1-benzofuran-2-carbonyl)-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 74047601) has the molecular formula C18H9Cl2NO3 and a molecular weight of 358.18 g/mol. Its IUPAC name is 2-(1-benzofuran-2-carbonyl)-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1-benzofuran-2-carbonyl)-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 74047601 |
| Molecular Formula | C18H9Cl2NO3 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-(1-benzofuran-2-carbonyl)-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(Cl)c(O)c(Cl)c1)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H9Cl2NO3/c19-13-6-10(7-14(20)18(13)23)5-12(9-21)17(22)16-8-11-3-1-2-4-15(11)24-16/h1-8,23H |
| InChIKey | IQMGWWFFLJUKSA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|