About 1-benzofuran-2-carboxamide;hydrate;dihydrochloride
1-benzofuran-2-carboxamide;hydrate;dihydrochloride (PubChem CID 144595737) has the molecular formula C9H11Cl2NO3
and a molecular weight of 252.10 g/mol. Its IUPAC name is 1-benzofuran-2-carboxamide;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 1-benzofuran-2-carboxamide;hydrate;dihydrochloride |
| PubChem CID | 144595737 |
| Molecular Formula | C9H11Cl2NO3 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 1-benzofuran-2-carboxamide;hydrate;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1cc2ccccc2o1.O |
| InChI | InChI=1S/C9H7NO2.2ClH.H2O/c10-9(11)8-5-6-3-1-2-4-7(6)12-8;;;/h1-5H,(H2,10,11);2*1H;1H2 |
| InChIKey | XNJBUVHERWFNRA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzofuran-2-carboxamide;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-carboxamide;hydrate;dihydrochloride?
The IUPAC name of 1-benzofuran-2-carboxamide;hydrate;dihydrochloride (CID 144595737) is 1-benzofuran-2-carboxamide;hydrate;dihydrochloride.
What is the SMILES notation for 1-benzofuran-2-carboxamide;hydrate;dihydrochloride?
The canonical SMILES for 1-benzofuran-2-carboxamide;hydrate;dihydrochloride is Cl.Cl.NC(=O)c1cc2ccccc2o1.O.
What is the InChIKey of 1-benzofuran-2-carboxamide;hydrate;dihydrochloride?
The InChIKey is XNJBUVHERWFNRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.2ClH.H2O/c10-9(11)8-5-6-3-1-2-4-7(6)12-8;;;/h1-5H,(H2,10,11);2*1H;1H2.
What are the key properties of 1-benzofuran-2-carboxamide;hydrate;dihydrochloride?
1-benzofuran-2-carboxamide;hydrate;dihydrochloride has a molecular weight of 252.10 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-carboxamide;hydrate;dihydrochloride is sourced from PubChem (CID 144595737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).