C14H16O2 — CID 114725277
1-(1-benzofuran-2-yl)-3,3-dimethylbutan-1-one (PubChem CID 114725277) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(1-benzofuran-2-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 114725277 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C14H16O2/c1-14(2,3)9-11(15)13-8-10-6-4-5-7-12(10)16-13/h4-8H,9H2,1-3H3 |
| InChIKey | RQYKPWYJVOKTCD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |