C13H14O2 — CID 13148492
1-(1-benzofuran-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 13148492) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(1-benzofuran-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 13148492 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H14O2/c1-13(2,3)12(14)11-8-9-6-4-5-7-10(9)15-11/h4-8H,1-3H3 |
| InChIKey | KXBTXZOQWXVVLF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |