C13H10F2O4 — CID 63089558
ethyl 3-(1-benzofuran-2-yl)-2,2-difluoro-3-oxopropanoate (PubChem CID 63089558) has the molecular formula C13H10F2O4 and a molecular weight of 268.21 g/mol. Its IUPAC name is ethyl 3-(1-benzofuran-2-yl)-2,2-difluoro-3-oxopropanoate.
| Compound Name | ethyl 3-(1-benzofuran-2-yl)-2,2-difluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 63089558 |
| Molecular Formula | C13H10F2O4 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | ethyl 3-(1-benzofuran-2-yl)-2,2-difluoro-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H10F2O4/c1-2-18-12(17)13(14,15)11(16)10-7-8-5-3-4-6-9(8)19-10/h3-7H,2H2,1H3 |
| InChIKey | PKXLCFQPLLHCRL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|