C12H12F2O4 — CID 55071398
ethyl 2,2-difluoro-3-(2-methoxyphenyl)-3-oxopropanoate (PubChem CID 55071398) has the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(2-methoxyphenyl)-3-oxopropanoate.
| Compound Name | ethyl 2,2-difluoro-3-(2-methoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 55071398 |
| Molecular Formula | C12H12F2O4 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | ethyl 2,2-difluoro-3-(2-methoxyphenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C12H12F2O4/c1-3-18-11(16)12(13,14)10(15)8-6-4-5-7-9(8)17-2/h4-7H,3H2,1-2H3 |
| InChIKey | WHXPGHOJUAJNTK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|