C11H8BrF3O3 — CID 107923908
ethyl 3-(2-bromo-5-fluorophenyl)-2,2-difluoro-3-oxopropanoate (PubChem CID 107923908) has the molecular formula C11H8BrF3O3 and a molecular weight of 325.08 g/mol. Its IUPAC name is ethyl 3-(2-bromo-5-fluorophenyl)-2,2-difluoro-3-oxopropanoate.
| Compound Name | ethyl 3-(2-bromo-5-fluorophenyl)-2,2-difluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 107923908 |
| Molecular Formula | C11H8BrF3O3 |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | ethyl 3-(2-bromo-5-fluorophenyl)-2,2-difluoro-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C11H8BrF3O3/c1-2-18-10(17)11(14,15)9(16)7-5-6(13)3-4-8(7)12/h3-5H,2H2,1H3 |
| InChIKey | WFRBPWNTFWEYHB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|