C24H26F4O7 — CID 175954637
ethyl 2-(2-ethoxy-5-fluorophenyl)-2,2-difluoroacetate;ethyl 2-(2-ethoxy-5-fluorophenyl)-2-oxoacetate (PubChem CID 175954637) has the molecular formula C24H26F4O7 and a molecular weight of 502.46 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-5-fluorophenyl)-2,2-difluoroacetate;ethyl 2-(2-ethoxy-5-fluorophenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(2-ethoxy-5-fluorophenyl)-2,2-difluoroacetate;ethyl 2-(2-ethoxy-5-fluorophenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 175954637 |
| Molecular Formula | C24H26F4O7 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | ethyl 2-(2-ethoxy-5-fluorophenyl)-2,2-difluoroacetate;ethyl 2-(2-ethoxy-5-fluorophenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(F)ccc1OCC.CCOC(=O)C(F)(F)c1cc(F)ccc1OCC |
| InChI | InChI=1S/C12H13F3O3.C12H13FO4/c1-3-17-10-6-5-8(13)7-9(10)12(14,15)11(16)18-4-2;1-3-16-10-6-5-8(13)7-9(10)11(14)12(15)17-4-2/h5-7H,3-4H2,1-2H3;5-7H,3-4H2,1-2H3 |
| InChIKey | FXMRFNYGQDCRBH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|