C12H10F4O4 — CID 118647237
ethyl 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]-2-oxoacetate (PubChem CID 118647237) has the molecular formula C12H10F4O4 and a molecular weight of 294.20 g/mol. Its IUPAC name is ethyl 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 118647237 |
| Molecular Formula | C12H10F4O4 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | ethyl 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(F)cc1OCC(F)(F)F |
| InChI | InChI=1S/C12H10F4O4/c1-2-19-11(18)10(17)8-4-3-7(13)5-9(8)20-6-12(14,15)16/h3-5H,2,6H2,1H3 |
| InChIKey | OTUCPHYODFWBCO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|