About CID 171632715
CID 171632715 (PubChem CID 171632715) has the molecular formula C11H9BO2
and a molecular weight of 184.00 g/mol.
Molecular Properties
| Compound Name | CID 171632715 |
| PubChem CID | 171632715 |
| Molecular Formula | C11H9BO2 |
| Molecular Weight | 184.00 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | — |
| SMILES | [B]C(C)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C11H9BO2/c1-7(12)11(13)10-6-8-4-2-3-5-9(8)14-10/h2-7H,1H3 |
| InChIKey | KUJNEZQZEDFJRO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.00 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 171632715 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171632715?
The IUPAC name of CID 171632715 (CID 171632715) is not available.
What is the SMILES notation for CID 171632715?
The canonical SMILES for CID 171632715 is [B]C(C)C(=O)c1cc2ccccc2o1.
What is the InChIKey of CID 171632715?
The InChIKey is KUJNEZQZEDFJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BO2/c1-7(12)11(13)10-6-8-4-2-3-5-9(8)14-10/h2-7H,1H3.
What are the key properties of CID 171632715?
CID 171632715 has a molecular weight of 184.00 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171632715 is sourced from PubChem (CID 171632715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).