C26H18N3O3- — CID 18724824
4-[(1E,3E,5E)-7-(1-benzofuran-2-yl)-6-cyano-7-oxohepta-1,3,5-trienyl]-3-methyl-1-phenylpyrazol-5-olate (PubChem CID 18724824) has the molecular formula C26H18N3O3- and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-[(1E,3E,5E)-7-(1-benzofuran-2-yl)-6-cyano-7-oxohepta-1,3,5-trienyl]-3-methyl-1-phenylpyrazol-5-olate.
| Compound Name | 4-[(1E,3E,5E)-7-(1-benzofuran-2-yl)-6-cyano-7-oxohepta-1,3,5-trienyl]-3-methyl-1-phenylpyrazol-5-olate |
|---|---|
| PubChem CID | 18724824 |
| Molecular Formula | C26H18N3O3- |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[(1E,3E,5E)-7-(1-benzofuran-2-yl)-6-cyano-7-oxohepta-1,3,5-trienyl]-3-methyl-1-phenylpyrazol-5-olate |
| SMILES | Cc1nn(-c2ccccc2)c([O-])c1/C=C/C=C/C=C(\C#N)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C26H19N3O3/c1-18-22(26(31)29(28-18)21-12-5-3-6-13-21)14-7-2-4-11-20(17-27)25(30)24-16-19-10-8-9-15-23(19)32-24/h2-16,31H,1H3/p-1/b4-2+,14-7+,20-11+ |
| InChIKey | XHLRJZADNGQHGF-STPCYKADSA-M |
| XLogP | 4.90 |
| TPSA | 94.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|