C24H17N3O4 — CID 5337244
ethyl (Z)-2-cyano-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 5337244) has the molecular formula C24H17N3O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 5337244 |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\c1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C24H17N3O4/c1-2-30-23(28)17(14-25)12-18-15-27(19-9-4-3-5-10-19)26-22(18)20-13-16-8-6-7-11-21(16)31-24(20)29/h3-13,15H,2H2,1H3/b17-12- |
| InChIKey | XKFCEHZBTLDHPI-ATVHPVEESA-N |
| XLogP | 4.12 |
| TPSA | 98.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|