C28H20N4O2 — CID 3313137
3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 3313137) has the molecular formula C28H20N4O2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3313137 |
| Molecular Formula | C28H20N4O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)C(C#N)=Cc2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C28H20N4O2/c1-19-8-7-10-23(14-19)30-28(33)21(17-29)15-22-18-32(24-11-3-2-4-12-24)31-27(22)26-16-20-9-5-6-13-25(20)34-26/h2-16,18H,1H3,(H,30,33) |
| InChIKey | CBCORXJUMJFYDP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|