C24H19N3O4 — CID 4669688
2-methoxyethyl 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 4669688) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-methoxyethyl 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | 2-methoxyethyl 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4669688 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-methoxyethyl 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | COCCOC(=O)C(C#N)=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H19N3O4/c1-29-11-12-30-24(28)18(15-25)13-19-16-27(20-8-3-2-4-9-20)26-23(19)22-14-17-7-5-6-10-21(17)31-22/h2-10,13-14,16H,11-12H2,1H3 |
| InChIKey | FFBGYVANOKLOJN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|