C14H14O5 — CID 54023522
5-(3,4,5-trimethoxyphenyl)pent-2-en-4-ynoic acid (PubChem CID 54023522) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-(3,4,5-trimethoxyphenyl)pent-2-en-4-ynoic acid.
| Compound Name | 5-(3,4,5-trimethoxyphenyl)pent-2-en-4-ynoic acid |
|---|---|
| PubChem CID | 54023522 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-(3,4,5-trimethoxyphenyl)pent-2-en-4-ynoic acid |
| SMILES | COc1cc(C#CC=CC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C14H14O5/c1-17-11-8-10(6-4-5-7-13(15)16)9-12(18-2)14(11)19-3/h5,7-9H,1-3H3,(H,15,16) |
| InChIKey | LAONTCVXRKTZNF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|