C15H16O5S — CID 167484971
S-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl] 2-oxopropanethioate (PubChem CID 167484971) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is S-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl] 2-oxopropanethioate.
| Compound Name | S-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl] 2-oxopropanethioate |
|---|---|
| PubChem CID | 167484971 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | S-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl] 2-oxopropanethioate |
| SMILES | COc1cc(C#CCSC(=O)C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C15H16O5S/c1-10(16)15(17)21-7-5-6-11-8-12(18-2)14(20-4)13(9-11)19-3/h8-9H,7H2,1-4H3 |
| InChIKey | GHOUMJBCAOBHJU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|