C20H17NO5 — CID 134973838
2-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl]isoindole-1,3-dione (PubChem CID 134973838) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134973838 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[3-(3,4,5-trimethoxyphenyl)prop-2-ynyl]isoindole-1,3-dione |
| SMILES | COc1cc(C#CCN2C(=O)c3ccccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H17NO5/c1-24-16-11-13(12-17(25-2)18(16)26-3)7-6-10-21-19(22)14-8-4-5-9-15(14)20(21)23/h4-5,8-9,11-12H,10H2,1-3H3 |
| InChIKey | HRXGUNGJXZAJEO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|