C16H10N2O2 — CID 177410226
2-(3-pyridin-2-ylprop-2-ynyl)isoindole-1,3-dione (PubChem CID 177410226) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-(3-pyridin-2-ylprop-2-ynyl)isoindole-1,3-dione.
| Compound Name | 2-(3-pyridin-2-ylprop-2-ynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177410226 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-(3-pyridin-2-ylprop-2-ynyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC#Cc1ccccn1 |
| InChI | InChI=1S/C16H10N2O2/c19-15-13-8-1-2-9-14(13)16(20)18(15)11-5-7-12-6-3-4-10-17-12/h1-4,6,8-10H,11H2 |
| InChIKey | PCOOWIUIMVNMHL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|