C28H27NO2 — CID 91280310
2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]prop-2-ynyl]isoindole-1,3-dione (PubChem CID 91280310) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]prop-2-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]prop-2-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91280310 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]prop-2-ynyl]isoindole-1,3-dione |
| SMILES | CC1=C(C=Cc2cccc(C#CCN3C(=O)c4ccccc4C3=O)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H27NO2/c1-20-9-7-17-28(2,3)25(20)16-15-22-11-6-10-21(19-22)12-8-18-29-26(30)23-13-4-5-14-24(23)27(29)31/h4-6,10-11,13-16,19H,7,9,17-18H2,1-3H3 |
| InChIKey | JZNGCKGJYPCUJK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|