C20H27ClO — CID 90747503
1-chloro-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol (PubChem CID 90747503) has the molecular formula C20H27ClO and a molecular weight of 318.89 g/mol. Its IUPAC name is 1-chloro-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol.
| Compound Name | 1-chloro-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 90747503 |
| Molecular Formula | C20H27ClO |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-chloro-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol |
| SMILES | CC1=C(C=Cc2cccc(CC(O)CCl)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H27ClO/c1-15-6-5-11-20(2,3)19(15)10-9-16-7-4-8-17(12-16)13-18(22)14-21/h4,7-10,12,18,22H,5-6,11,13-14H2,1-3H3 |
| InChIKey | YKWJEZBYGBGNKN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|