C20H27N3O — CID 91248802
1-azido-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol (PubChem CID 91248802) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-azido-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol.
| Compound Name | 1-azido-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 91248802 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-azido-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol |
| SMILES | CC1=C(C=Cc2cccc(CC(O)CN=[N+]=[N-])c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H27N3O/c1-15-6-5-11-20(2,3)19(15)10-9-16-7-4-8-17(12-16)13-18(24)14-22-23-21/h4,7-10,12,18,24H,5-6,11,13-14H2,1-3H3 |
| InChIKey | BQBHBNBBOKXACC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|