C22H33NO — CID 68942956
2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propylamino]ethanol (PubChem CID 68942956) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is 2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propylamino]ethanol.
| Compound Name | 2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propylamino]ethanol |
|---|---|
| PubChem CID | 68942956 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 2-[3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propylamino]ethanol |
| SMILES | CC1=C(C=Cc2cccc(CCCNCCO)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H33NO/c1-18-7-5-13-22(2,3)21(18)12-11-20-9-4-8-19(17-20)10-6-14-23-15-16-24/h4,8-9,11-12,17,23-24H,5-7,10,13-16H2,1-3H3 |
| InChIKey | AETORJPTIHURGC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|