C21H26O — CID 85152034
3-methyl-5-phenyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol (PubChem CID 85152034) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-methyl-5-phenyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol.
| Compound Name | 3-methyl-5-phenyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 85152034 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 3-methyl-5-phenyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol |
| SMILES | CC1=C(C=CC(C)(O)C#Cc2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H26O/c1-17-9-8-14-20(2,3)19(17)13-16-21(4,22)15-12-18-10-6-5-7-11-18/h5-7,10-11,13,16,22H,8-9,14H2,1-4H3 |
| InChIKey | QYDDWGGJPPTURQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|