C23H30O3 — CID 91096174
[3-methoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl] benzoate (PubChem CID 91096174) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [3-methoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl] benzoate.
| Compound Name | [3-methoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl] benzoate |
|---|---|
| PubChem CID | 91096174 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [3-methoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl] benzoate |
| SMILES | COC(C)(C=COC(=O)c1ccccc1)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H30O3/c1-18-10-9-14-22(2,3)20(18)13-15-23(4,25-5)16-17-26-21(24)19-11-7-6-8-12-19/h6-8,11-13,15-17H,9-10,14H2,1-5H3 |
| InChIKey | AAIJQJKPWORDRA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|