C26H28O — CID 44591382
(1E,4E)-1-(4-phenylphenyl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one (PubChem CID 44591382) has the molecular formula C26H28O and a molecular weight of 356.51 g/mol. Its IUPAC name is (1E,4E)-1-(4-phenylphenyl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(4-phenylphenyl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44591382 |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (1E,4E)-1-(4-phenylphenyl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=C(/C=C/C(=O)/C=C/c2ccc(-c3ccccc3)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H28O/c1-20-8-7-19-26(2,3)25(20)18-17-24(27)16-13-21-11-14-23(15-12-21)22-9-5-4-6-10-22/h4-6,9-18H,7-8,19H2,1-3H3/b16-13+,18-17+ |
| InChIKey | TVPXMACTYIKRNR-MTUSAYGMSA-N |
| XLogP | 7.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|