C29H32O — CID 44586780
4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-2-phenylbenzaldehyde (PubChem CID 44586780) has the molecular formula C29H32O and a molecular weight of 396.57 g/mol. Its IUPAC name is 4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-2-phenylbenzaldehyde.
| Compound Name | 4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-2-phenylbenzaldehyde |
|---|---|
| PubChem CID | 44586780 |
| Molecular Formula | C29H32O |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-2-phenylbenzaldehyde |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/c2ccc(C=O)c(-c3ccccc3)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H32O/c1-22(15-18-28-23(2)11-9-19-29(28,3)4)10-8-12-24-16-17-26(21-30)27(20-24)25-13-6-5-7-14-25/h5-8,10,12-18,20-21H,9,11,19H2,1-4H3/b12-8+,18-15+,22-10+ |
| InChIKey | NOUNXYOEXULKGC-YVSMFRTISA-N |
| XLogP | 8.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|